C5H6F7N — CID 96572524
(2S)-3,3,4,4,5,5,5-heptafluoropentan-2-amine (PubChem CID 96572524) has the molecular formula C5H6F7N and a molecular weight of 213.10 g/mol. Its IUPAC name is (2S)-3,3,4,4,5,5,5-heptafluoropentan-2-amine.
| Compound Name | (2S)-3,3,4,4,5,5,5-heptafluoropentan-2-amine |
|---|---|
| PubChem CID | 96572524 |
| Molecular Formula | C5H6F7N |
| Molecular Weight | 213.10 g/mol |
| Exact Mass | 213.04 |
| IUPAC Name | (2S)-3,3,4,4,5,5,5-heptafluoropentan-2-amine |
| SMILES | C[C@H](N)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C5H6F7N/c1-2(13)3(6,7)4(8,9)5(10,11)12/h2H,13H2,1H3/t2-/m0/s1 |
| InChIKey | VYXXEPNGYRIBCL-REOHCLBHSA-N |
| XLogP | 2.17 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.10 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|