C6H9ClF7N — CID 171210343
(3R)-4,4,5,5,6,6,6-heptafluorohexan-3-amine;hydrochloride (PubChem CID 171210343) has the molecular formula C6H9ClF7N and a molecular weight of 263.58 g/mol. Its IUPAC name is (3R)-4,4,5,5,6,6,6-heptafluorohexan-3-amine;hydrochloride.
| Compound Name | (3R)-4,4,5,5,6,6,6-heptafluorohexan-3-amine;hydrochloride |
|---|---|
| PubChem CID | 171210343 |
| Molecular Formula | C6H9ClF7N |
| Molecular Weight | 263.58 g/mol |
| Exact Mass | 263.03 |
| IUPAC Name | (3R)-4,4,5,5,6,6,6-heptafluorohexan-3-amine;hydrochloride |
| SMILES | CC[C@@H](N)C(F)(F)C(F)(F)C(F)(F)F.Cl |
| InChI | InChI=1S/C6H8F7N.ClH/c1-2-3(14)4(7,8)5(9,10)6(11,12)13;/h3H,2,14H2,1H3;1H/t3-;/m1./s1 |
| InChIKey | BAYBDLHSOVJSGJ-AENDTGMFSA-N |
| XLogP | 2.98 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.58 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|