C7H8F7I — CID 151585042
1,1,1,2,2,3,3-heptafluoro-4-iodoheptane (PubChem CID 151585042) has the molecular formula C7H8F7I and a molecular weight of 352.03 g/mol. Its IUPAC name is 1,1,1,2,2,3,3-heptafluoro-4-iodoheptane.
| Compound Name | 1,1,1,2,2,3,3-heptafluoro-4-iodoheptane |
|---|---|
| PubChem CID | 151585042 |
| Molecular Formula | C7H8F7I |
| Molecular Weight | 352.03 g/mol |
| Exact Mass | 351.96 |
| IUPAC Name | 1,1,1,2,2,3,3-heptafluoro-4-iodoheptane |
| SMILES | CCCC(I)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C7H8F7I/c1-2-3-4(15)5(8,9)6(10,11)7(12,13)14/h4H,2-3H2,1H3 |
| InChIKey | QHHREBVEKCDDPF-UHFFFAOYSA-N |
| XLogP | 4.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.03 |
| LogP ≤ 5 | 4.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|