C15H19F13O — CID 149252552
1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoropentadecan-7-ol (PubChem CID 149252552) has the molecular formula C15H19F13O and a molecular weight of 462.29 g/mol. Its IUPAC name is 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoropentadecan-7-ol.
| Compound Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoropentadecan-7-ol |
|---|---|
| PubChem CID | 149252552 |
| Molecular Formula | C15H19F13O |
| Molecular Weight | 462.29 g/mol |
| Exact Mass | 462.12 |
| IUPAC Name | 1,1,1,2,2,3,3,4,4,5,5,6,6-tridecafluoropentadecan-7-ol |
| SMILES | CCCCCCCCC(O)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| InChI | InChI=1S/C15H19F13O/c1-2-3-4-5-6-7-8-9(29)10(16,17)11(18,19)12(20,21)13(22,23)14(24,25)15(26,27)28/h9,29H,2-8H2,1H3 |
| InChIKey | WTHYOQMDMABEKC-UHFFFAOYSA-N |
| XLogP | 6.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.29 |
| LogP ≤ 5 | 6.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|