C8H13BrF4O — CID 533683
1-bromo-1,1,2,2-tetrafluorooctan-3-ol (PubChem CID 533683) has the molecular formula C8H13BrF4O and a molecular weight of 281.09 g/mol. Its IUPAC name is 1-bromo-1,1,2,2-tetrafluorooctan-3-ol.
| Compound Name | 1-bromo-1,1,2,2-tetrafluorooctan-3-ol |
|---|---|
| PubChem CID | 533683 |
| Molecular Formula | C8H13BrF4O |
| Molecular Weight | 281.09 g/mol |
| Exact Mass | 280.01 |
| IUPAC Name | 1-bromo-1,1,2,2-tetrafluorooctan-3-ol |
| SMILES | CCCCCC(O)C(F)(F)C(F)(F)Br |
| InChI | InChI=1S/C8H13BrF4O/c1-2-3-4-5-6(14)7(10,11)8(9,12)13/h6,14H,2-5H2,1H3 |
| InChIKey | AXBZKQKVSKVCNT-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.09 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|