C11H21F3O — CID 2779105
(2R)-1,1,1-trifluoroundecan-2-ol (PubChem CID 2779105) has the molecular formula C11H21F3O and a molecular weight of 226.28 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoroundecan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoroundecan-2-ol |
|---|---|
| PubChem CID | 2779105 |
| Molecular Formula | C11H21F3O |
| Molecular Weight | 226.28 g/mol |
| Exact Mass | 226.15 |
| IUPAC Name | (2R)-1,1,1-trifluoroundecan-2-ol |
| SMILES | CCCCCCCCC[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C11H21F3O/c1-2-3-4-5-6-7-8-9-10(15)11(12,13)14/h10,15H,2-9H2,1H3/t10-/m1/s1 |
| InChIKey | FBHJYJKWINPBSZ-SNVBAGLBSA-N |
| XLogP | 4.05 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.28 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|