C9H17F3O — CID 18396357
(2R)-1,1,1-trifluoro-7-methyloctan-2-ol (PubChem CID 18396357) has the molecular formula C9H17F3O and a molecular weight of 198.23 g/mol. Its IUPAC name is (2R)-1,1,1-trifluoro-7-methyloctan-2-ol.
| Compound Name | (2R)-1,1,1-trifluoro-7-methyloctan-2-ol |
|---|---|
| PubChem CID | 18396357 |
| Molecular Formula | C9H17F3O |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.12 |
| IUPAC Name | (2R)-1,1,1-trifluoro-7-methyloctan-2-ol |
| SMILES | CC(C)CCCC[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C9H17F3O/c1-7(2)5-3-4-6-8(13)9(10,11)12/h7-8,13H,3-6H2,1-2H3/t8-/m1/s1 |
| InChIKey | JVNBPZYIRWCHQU-MRVPVSSYSA-N |
| XLogP | 3.13 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 3.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|