C9H17F3O2 — CID 10198260
(2R)-7-ethoxy-1,1,1-trifluoroheptan-2-ol (PubChem CID 10198260) has the molecular formula C9H17F3O2 and a molecular weight of 214.23 g/mol. Its IUPAC name is (2R)-7-ethoxy-1,1,1-trifluoroheptan-2-ol.
| Compound Name | (2R)-7-ethoxy-1,1,1-trifluoroheptan-2-ol |
|---|---|
| PubChem CID | 10198260 |
| Molecular Formula | C9H17F3O2 |
| Molecular Weight | 214.23 g/mol |
| Exact Mass | 214.12 |
| IUPAC Name | (2R)-7-ethoxy-1,1,1-trifluoroheptan-2-ol |
| SMILES | CCOCCCCC[C@@H](O)C(F)(F)F |
| InChI | InChI=1S/C9H17F3O2/c1-2-14-7-5-3-4-6-8(13)9(10,11)12/h8,13H,2-7H2,1H3/t8-/m1/s1 |
| InChIKey | VXSKCAORLFNLGG-MRVPVSSYSA-N |
| XLogP | 2.51 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.23 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|