C10H17F3O5 — CID 22481559
2-(2-ethoxyethoxy)ethyl 4,4,4-trifluoro-3-hydroxybutanoate (PubChem CID 22481559) has the molecular formula C10H17F3O5 and a molecular weight of 274.23 g/mol. Its IUPAC name is 2-(2-ethoxyethoxy)ethyl 4,4,4-trifluoro-3-hydroxybutanoate.
| Compound Name | 2-(2-ethoxyethoxy)ethyl 4,4,4-trifluoro-3-hydroxybutanoate |
|---|---|
| PubChem CID | 22481559 |
| Molecular Formula | C10H17F3O5 |
| Molecular Weight | 274.23 g/mol |
| Exact Mass | 274.10 |
| IUPAC Name | 2-(2-ethoxyethoxy)ethyl 4,4,4-trifluoro-3-hydroxybutanoate |
| SMILES | CCOCCOCCOC(=O)CC(O)C(F)(F)F |
| InChI | InChI=1S/C10H17F3O5/c1-2-16-3-4-17-5-6-18-9(15)7-8(14)10(11,12)13/h8,14H,2-7H2,1H3 |
| InChIKey | ZCYFXINXGRIRTF-UHFFFAOYSA-N |
| XLogP | 0.90 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.23 |
| LogP ≤ 5 | 0.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|