About 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate
2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate (PubChem CID 121008376) has the molecular formula C12H22O7
and a molecular weight of 278.30 g/mol. Its IUPAC name is 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate.
Molecular Properties
| Compound Name | 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate |
| PubChem CID | 121008376 |
| Molecular Formula | C12H22O7 |
| Molecular Weight | 278.30 g/mol |
| Exact Mass | 278.14 |
| IUPAC Name | 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCCOCCOC(=O)COCC |
| InChI | InChI=1S/C12H22O7/c1-3-15-9-11(13)18-7-5-17-6-8-19-12(14)10-16-4-2/h3-10H2,1-2H3 |
| InChIKey | OPNMJQALEBKREI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 80.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 278.30 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate?
The IUPAC name of 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate (CID 121008376) is 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate.
What is the SMILES notation for 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate?
The canonical SMILES for 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate is CCOCC(=O)OCCOCCOC(=O)COCC.
What is the InChIKey of 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate?
The InChIKey is OPNMJQALEBKREI-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H22O7/c1-3-15-9-11(13)18-7-5-17-6-8-19-12(14)10-16-4-2/h3-10H2,1-2H3.
What are the key properties of 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate?
2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate has a molecular weight of 278.30 g/mol, XLogP of 0.16, 12 rotatable bonds, 0 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 2-[2-(2-ethoxyacetyl)oxyethoxy]ethyl 2-ethoxyacetate is sourced from PubChem (CID 121008376), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).