About 2-ethoxyethyl 2-fluoroacetate
2-ethoxyethyl 2-fluoroacetate (PubChem CID 88537895) has the molecular formula C6H11FO3
and a molecular weight of 150.15 g/mol. Its IUPAC name is 2-ethoxyethyl 2-fluoroacetate.
Molecular Properties
| Compound Name | 2-ethoxyethyl 2-fluoroacetate |
| PubChem CID | 88537895 |
| Molecular Formula | C6H11FO3 |
| Molecular Weight | 150.15 g/mol |
| Exact Mass | 150.07 |
| IUPAC Name | 2-ethoxyethyl 2-fluoroacetate |
| SMILES | CCOCCOC(=O)CF |
| InChI | InChI=1S/C6H11FO3/c1-2-9-3-4-10-6(8)5-7/h2-5H2,1H3 |
| InChIKey | XWZGLZVKJPCTFK-UHFFFAOYSA-N |
| XLogP | 0.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 150.15 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-ethoxyethyl 2-fluoroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethoxyethyl 2-fluoroacetate?
The IUPAC name of 2-ethoxyethyl 2-fluoroacetate (CID 88537895) is 2-ethoxyethyl 2-fluoroacetate.
What is the SMILES notation for 2-ethoxyethyl 2-fluoroacetate?
The canonical SMILES for 2-ethoxyethyl 2-fluoroacetate is CCOCCOC(=O)CF.
What is the InChIKey of 2-ethoxyethyl 2-fluoroacetate?
The InChIKey is XWZGLZVKJPCTFK-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H11FO3/c1-2-9-3-4-10-6(8)5-7/h2-5H2,1H3.
What are the key properties of 2-ethoxyethyl 2-fluoroacetate?
2-ethoxyethyl 2-fluoroacetate has a molecular weight of 150.15 g/mol, XLogP of 0.54, 5 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethoxyethyl 2-fluoroacetate is sourced from PubChem (CID 88537895), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).