C15H29F3O2 — CID 139609821
1,1,1-trifluoro-6-nonoxyhexan-2-ol (PubChem CID 139609821) has the molecular formula C15H29F3O2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 1,1,1-trifluoro-6-nonoxyhexan-2-ol.
| Compound Name | 1,1,1-trifluoro-6-nonoxyhexan-2-ol |
|---|---|
| PubChem CID | 139609821 |
| Molecular Formula | C15H29F3O2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.21 |
| IUPAC Name | 1,1,1-trifluoro-6-nonoxyhexan-2-ol |
| SMILES | CCCCCCCCCOCCCCC(O)C(F)(F)F |
| InChI | InChI=1S/C15H29F3O2/c1-2-3-4-5-6-7-9-12-20-13-10-8-11-14(19)15(16,17)18/h14,19H,2-13H2,1H3 |
| InChIKey | CGDZKXGWUANSIU-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|