C15H19F5O2 — CID 132579103
1,1,2,2-tetrafluoro-1-(4-fluorophenoxy)nonan-3-ol (PubChem CID 132579103) has the molecular formula C15H19F5O2 and a molecular weight of 326.31 g/mol. Its IUPAC name is 1,1,2,2-tetrafluoro-1-(4-fluorophenoxy)nonan-3-ol.
| Compound Name | 1,1,2,2-tetrafluoro-1-(4-fluorophenoxy)nonan-3-ol |
|---|---|
| PubChem CID | 132579103 |
| Molecular Formula | C15H19F5O2 |
| Molecular Weight | 326.31 g/mol |
| Exact Mass | 326.13 |
| IUPAC Name | 1,1,2,2-tetrafluoro-1-(4-fluorophenoxy)nonan-3-ol |
| SMILES | CCCCCCC(O)C(F)(F)C(F)(F)Oc1ccc(F)cc1 |
| InChI | InChI=1S/C15H19F5O2/c1-2-3-4-5-6-13(21)14(17,18)15(19,20)22-12-9-7-11(16)8-10-12/h7-10,13,21H,2-6H2,1H3 |
| InChIKey | FNNKABWFRNTCQP-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.31 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|