C10H18BrF3 — CID 98120472
(2R)-2-bromo-1,1,1-trifluorodecane (PubChem CID 98120472) has the molecular formula C10H18BrF3 and a molecular weight of 275.15 g/mol. Its IUPAC name is (2R)-2-bromo-1,1,1-trifluorodecane.
| Compound Name | (2R)-2-bromo-1,1,1-trifluorodecane |
|---|---|
| PubChem CID | 98120472 |
| Molecular Formula | C10H18BrF3 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.05 |
| IUPAC Name | (2R)-2-bromo-1,1,1-trifluorodecane |
| SMILES | CCCCCCCC[C@@H](Br)C(F)(F)F |
| InChI | InChI=1S/C10H18BrF3/c1-2-3-4-5-6-7-8-9(11)10(12,13)14/h9H,2-8H2,1H3/t9-/m1/s1 |
| InChIKey | XYSXKYRVEZBHJJ-SECBINFHSA-N |
| XLogP | 5.06 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 5.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|