About 2-bromo-1-fluorododecane
2-bromo-1-fluorododecane (PubChem CID 12938124) has the molecular formula C12H24BrF
and a molecular weight of 267.23 g/mol. Its IUPAC name is 2-bromo-1-fluorododecane.
Molecular Properties
| Compound Name | 2-bromo-1-fluorododecane |
| PubChem CID | 12938124 |
| Molecular Formula | C12H24BrF |
| Molecular Weight | 267.23 g/mol |
| Exact Mass | 266.10 |
| IUPAC Name | 2-bromo-1-fluorododecane |
| SMILES | CCCCCCCCCCC(Br)CF |
| InChI | InChI=1S/C12H24BrF/c1-2-3-4-5-6-7-8-9-10-12(13)11-14/h12H,2-11H2,1H3 |
| InChIKey | YVCRNMJMGDUFRY-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 10 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 267.23 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-fluorododecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-fluorododecane?
The IUPAC name of 2-bromo-1-fluorododecane (CID 12938124) is 2-bromo-1-fluorododecane.
What is the SMILES notation for 2-bromo-1-fluorododecane?
The canonical SMILES for 2-bromo-1-fluorododecane is CCCCCCCCCCC(Br)CF.
What is the InChIKey of 2-bromo-1-fluorododecane?
The InChIKey is YVCRNMJMGDUFRY-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H24BrF/c1-2-3-4-5-6-7-8-9-10-12(13)11-14/h12H,2-11H2,1H3.
What are the key properties of 2-bromo-1-fluorododecane?
2-bromo-1-fluorododecane has a molecular weight of 267.23 g/mol, XLogP of 5.25, 10 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-fluorododecane is sourced from PubChem (CID 12938124), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).