About 1,3-dibromopentadecane
1,3-dibromopentadecane (PubChem CID 122583568) has the molecular formula C15H30Br2
and a molecular weight of 370.21 g/mol. Its IUPAC name is 1,3-dibromopentadecane.
Molecular Properties
| Compound Name | 1,3-dibromopentadecane |
| PubChem CID | 122583568 |
| Molecular Formula | C15H30Br2 |
| Molecular Weight | 370.21 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | 1,3-dibromopentadecane |
| SMILES | CCCCCCCCCCCCC(Br)CCBr |
| InChI | InChI=1S/C15H30Br2/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13-14-16/h15H,2-14H2,1H3 |
| InChIKey | CYKCGDNMCJXBAI-UHFFFAOYSA-N |
| XLogP | 6.85 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 370.21 |
| LogP ≤ 5 | 6.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1,3-dibromopentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-dibromopentadecane?
The IUPAC name of 1,3-dibromopentadecane (CID 122583568) is 1,3-dibromopentadecane.
What is the SMILES notation for 1,3-dibromopentadecane?
The canonical SMILES for 1,3-dibromopentadecane is CCCCCCCCCCCCC(Br)CCBr.
What is the InChIKey of 1,3-dibromopentadecane?
The InChIKey is CYKCGDNMCJXBAI-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30Br2/c1-2-3-4-5-6-7-8-9-10-11-12-15(17)13-14-16/h15H,2-14H2,1H3.
What are the key properties of 1,3-dibromopentadecane?
1,3-dibromopentadecane has a molecular weight of 370.21 g/mol, XLogP of 6.85, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-dibromopentadecane is sourced from PubChem (CID 122583568), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).