About 6-bromopentadecane
6-bromopentadecane (PubChem CID 86639780) has the molecular formula C15H31Br
and a molecular weight of 291.32 g/mol. Its IUPAC name is 6-bromopentadecane.
Molecular Properties
| Compound Name | 6-bromopentadecane |
| PubChem CID | 86639780 |
| Molecular Formula | C15H31Br |
| Molecular Weight | 291.32 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | 6-bromopentadecane |
| SMILES | CCCCCCCCCC(Br)CCCCC |
| InChI | InChI=1S/C15H31Br/c1-3-5-7-8-9-10-12-14-15(16)13-11-6-4-2/h15H,3-14H2,1-2H3 |
| InChIKey | LQLVGPZQQAADMS-UHFFFAOYSA-N |
| XLogP | 6.47 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 291.32 |
| LogP ≤ 5 | 6.47 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 6-bromopentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromopentadecane?
The IUPAC name of 6-bromopentadecane (CID 86639780) is 6-bromopentadecane.
What is the SMILES notation for 6-bromopentadecane?
The canonical SMILES for 6-bromopentadecane is CCCCCCCCCC(Br)CCCCC.
What is the InChIKey of 6-bromopentadecane?
The InChIKey is LQLVGPZQQAADMS-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H31Br/c1-3-5-7-8-9-10-12-14-15(16)13-11-6-4-2/h15H,3-14H2,1-2H3.
What are the key properties of 6-bromopentadecane?
6-bromopentadecane has a molecular weight of 291.32 g/mol, XLogP of 6.47, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromopentadecane is sourced from PubChem (CID 86639780), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).