About 9-bromooctadec-1-ene
9-bromooctadec-1-ene (PubChem CID 167439794) has the molecular formula C18H35Br
and a molecular weight of 331.38 g/mol. Its IUPAC name is 9-bromooctadec-1-ene.
Molecular Properties
| Compound Name | 9-bromooctadec-1-ene |
| PubChem CID | 167439794 |
| Molecular Formula | C18H35Br |
| Molecular Weight | 331.38 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | 9-bromooctadec-1-ene |
| SMILES | C=CCCCCCCC(Br)CCCCCCCCC |
| InChI | InChI=1S/C18H35Br/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2/h4,18H,2-3,5-17H2,1H3 |
| InChIKey | DYLSXRYSSDJPIN-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 331.38 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 9-bromooctadec-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9-bromooctadec-1-ene?
The IUPAC name of 9-bromooctadec-1-ene (CID 167439794) is 9-bromooctadec-1-ene.
What is the SMILES notation for 9-bromooctadec-1-ene?
The canonical SMILES for 9-bromooctadec-1-ene is C=CCCCCCCC(Br)CCCCCCCCC.
What is the InChIKey of 9-bromooctadec-1-ene?
The InChIKey is DYLSXRYSSDJPIN-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H35Br/c1-3-5-7-9-11-13-15-17-18(19)16-14-12-10-8-6-4-2/h4,18H,2-3,5-17H2,1H3.
What are the key properties of 9-bromooctadec-1-ene?
9-bromooctadec-1-ene has a molecular weight of 331.38 g/mol, XLogP of 7.42, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9-bromooctadec-1-ene is sourced from PubChem (CID 167439794), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).