About 3-bromooctadecane;methanamine
3-bromooctadecane;methanamine (PubChem CID 172853004) has the molecular formula C19H42BrN
and a molecular weight of 364.46 g/mol. Its IUPAC name is 3-bromooctadecane;methanamine.
Molecular Properties
| Compound Name | 3-bromooctadecane;methanamine |
| PubChem CID | 172853004 |
| Molecular Formula | C19H42BrN |
| Molecular Weight | 364.46 g/mol |
| Exact Mass | 363.25 |
| IUPAC Name | 3-bromooctadecane;methanamine |
| SMILES | CCCCCCCCCCCCCCCC(Br)CC.CN |
| InChI | InChI=1S/C18H37Br.CH5N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)4-2;1-2/h18H,3-17H2,1-2H3;2H2,1H3 |
| InChIKey | YHXZGKIPCMVATO-UHFFFAOYSA-N |
| XLogP | 7.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 364.46 |
| LogP ≤ 5 | 7.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromooctadecane;methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromooctadecane;methanamine?
The IUPAC name of 3-bromooctadecane;methanamine (CID 172853004) is 3-bromooctadecane;methanamine.
What is the SMILES notation for 3-bromooctadecane;methanamine?
The canonical SMILES for 3-bromooctadecane;methanamine is CCCCCCCCCCCCCCCC(Br)CC.CN.
What is the InChIKey of 3-bromooctadecane;methanamine?
The InChIKey is YHXZGKIPCMVATO-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H37Br.CH5N/c1-3-5-6-7-8-9-10-11-12-13-14-15-16-17-18(19)4-2;1-2/h18H,3-17H2,1-2H3;2H2,1H3.
What are the key properties of 3-bromooctadecane;methanamine?
3-bromooctadecane;methanamine has a molecular weight of 364.46 g/mol, XLogP of 7.22, 15 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromooctadecane;methanamine is sourced from PubChem (CID 172853004), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).