About 2-bromo-1-fluoroheptane
2-bromo-1-fluoroheptane (PubChem CID 14433707) has the molecular formula C7H14BrF
and a molecular weight of 197.09 g/mol. Its IUPAC name is 2-bromo-1-fluoroheptane.
Molecular Properties
| Compound Name | 2-bromo-1-fluoroheptane |
| PubChem CID | 14433707 |
| Molecular Formula | C7H14BrF |
| Molecular Weight | 197.09 g/mol |
| Exact Mass | 196.03 |
| IUPAC Name | 2-bromo-1-fluoroheptane |
| SMILES | CCCCCC(Br)CF |
| InChI | InChI=1S/C7H14BrF/c1-2-3-4-5-7(8)6-9/h7H,2-6H2,1H3 |
| InChIKey | NFWVAXRPHHCLHN-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.09 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 2-bromo-1-fluoroheptane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-bromo-1-fluoroheptane?
The IUPAC name of 2-bromo-1-fluoroheptane (CID 14433707) is 2-bromo-1-fluoroheptane.
What is the SMILES notation for 2-bromo-1-fluoroheptane?
The canonical SMILES for 2-bromo-1-fluoroheptane is CCCCCC(Br)CF.
What is the InChIKey of 2-bromo-1-fluoroheptane?
The InChIKey is NFWVAXRPHHCLHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14BrF/c1-2-3-4-5-7(8)6-9/h7H,2-6H2,1H3.
What are the key properties of 2-bromo-1-fluoroheptane?
2-bromo-1-fluoroheptane has a molecular weight of 197.09 g/mol, XLogP of 3.30, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-bromo-1-fluoroheptane is sourced from PubChem (CID 14433707), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).