About 3-bromo-1,1-difluorononane
3-bromo-1,1-difluorononane (PubChem CID 24977728) has the molecular formula C9H17BrF2
and a molecular weight of 243.13 g/mol. Its IUPAC name is 3-bromo-1,1-difluorononane.
Molecular Properties
| Compound Name | 3-bromo-1,1-difluorononane |
| PubChem CID | 24977728 |
| Molecular Formula | C9H17BrF2 |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 242.05 |
| IUPAC Name | 3-bromo-1,1-difluorononane |
| SMILES | CCCCCCC(Br)CC(F)F |
| InChI | InChI=1S/C9H17BrF2/c1-2-3-4-5-6-8(10)7-9(11)12/h8-9H,2-7H2,1H3 |
| InChIKey | AKKPYLDUESBDRJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 3-bromo-1,1-difluorononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-bromo-1,1-difluorononane?
The IUPAC name of 3-bromo-1,1-difluorononane (CID 24977728) is 3-bromo-1,1-difluorononane.
What is the SMILES notation for 3-bromo-1,1-difluorononane?
The canonical SMILES for 3-bromo-1,1-difluorononane is CCCCCCC(Br)CC(F)F.
What is the InChIKey of 3-bromo-1,1-difluorononane?
The InChIKey is AKKPYLDUESBDRJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H17BrF2/c1-2-3-4-5-6-8(10)7-9(11)12/h8-9H,2-7H2,1H3.
What are the key properties of 3-bromo-1,1-difluorononane?
3-bromo-1,1-difluorononane has a molecular weight of 243.13 g/mol, XLogP of 4.38, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 3-bromo-1,1-difluorononane is sourced from PubChem (CID 24977728), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).