About 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane
8-[(2S)-4,4-difluorobutan-2-yl]pentadecane (PubChem CID 154930347) has the molecular formula C19H38F2
and a molecular weight of 304.51 g/mol. Its IUPAC name is 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane.
Molecular Properties
| Compound Name | 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane |
| PubChem CID | 154930347 |
| Molecular Formula | C19H38F2 |
| Molecular Weight | 304.51 g/mol |
| Exact Mass | 304.29 |
| IUPAC Name | 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane |
| SMILES | CCCCCCCC(CCCCCCC)[C@@H](C)CC(F)F |
| InChI | InChI=1S/C19H38F2/c1-4-6-8-10-12-14-18(17(3)16-19(20)21)15-13-11-9-7-5-2/h17-19H,4-16H2,1-3H3/t17-/m0/s1 |
| InChIKey | HRJMFQZBGOYTTI-KRWDZBQOSA-N |
| XLogP | 7.61 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 304.51 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane?
The IUPAC name of 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane (CID 154930347) is 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane.
What is the SMILES notation for 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane?
The canonical SMILES for 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane is CCCCCCCC(CCCCCCC)[C@@H](C)CC(F)F.
What is the InChIKey of 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane?
The InChIKey is HRJMFQZBGOYTTI-KRWDZBQOSA-N. The full InChI is InChI=1S/C19H38F2/c1-4-6-8-10-12-14-18(17(3)16-19(20)21)15-13-11-9-7-5-2/h17-19H,4-16H2,1-3H3/t17-/m0/s1.
What are the key properties of 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane?
8-[(2S)-4,4-difluorobutan-2-yl]pentadecane has a molecular weight of 304.51 g/mol, XLogP of 7.61, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(2S)-4,4-difluorobutan-2-yl]pentadecane is sourced from PubChem (CID 154930347), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).