About 9,10-diethyloctadecane
9,10-diethyloctadecane (PubChem CID 530164) has the molecular formula C22H46
and a molecular weight of 310.61 g/mol. Its IUPAC name is 9,10-diethyloctadecane.
Molecular Properties
| Compound Name | 9,10-diethyloctadecane |
| PubChem CID | 530164 |
| Molecular Formula | C22H46 |
| Molecular Weight | 310.61 g/mol |
| Exact Mass | 310.36 |
| IUPAC Name | 9,10-diethyloctadecane |
| SMILES | CCCCCCCCC(CC)C(CC)CCCCCCCC |
| InChI | InChI=1S/C22H46/c1-5-9-11-13-15-17-19-21(7-3)22(8-4)20-18-16-14-12-10-6-2/h21-22H,5-20H2,1-4H3 |
| InChIKey | AVZUSORDOHPBIA-UHFFFAOYSA-N |
| XLogP | 8.54 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 17 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 310.61 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 9,10-diethyloctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 9,10-diethyloctadecane?
The IUPAC name of 9,10-diethyloctadecane (CID 530164) is 9,10-diethyloctadecane.
What is the SMILES notation for 9,10-diethyloctadecane?
The canonical SMILES for 9,10-diethyloctadecane is CCCCCCCCC(CC)C(CC)CCCCCCCC.
What is the InChIKey of 9,10-diethyloctadecane?
The InChIKey is AVZUSORDOHPBIA-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H46/c1-5-9-11-13-15-17-19-21(7-3)22(8-4)20-18-16-14-12-10-6-2/h21-22H,5-20H2,1-4H3.
What are the key properties of 9,10-diethyloctadecane?
9,10-diethyloctadecane has a molecular weight of 310.61 g/mol, XLogP of 8.54, 17 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 9,10-diethyloctadecane is sourced from PubChem (CID 530164), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).