About 5,6-diethyldodecane
5,6-diethyldodecane (PubChem CID 90761715) has the molecular formula C16H34
and a molecular weight of 226.45 g/mol. Its IUPAC name is 5,6-diethyldodecane.
Molecular Properties
| Compound Name | 5,6-diethyldodecane |
| PubChem CID | 90761715 |
| Molecular Formula | C16H34 |
| Molecular Weight | 226.45 g/mol |
| Exact Mass | 226.27 |
| IUPAC Name | 5,6-diethyldodecane |
| SMILES | CCCCCCC(CC)C(CC)CCCC |
| InChI | InChI=1S/C16H34/c1-5-9-11-12-14-16(8-4)15(7-3)13-10-6-2/h15-16H,5-14H2,1-4H3 |
| InChIKey | HGYFPKFQXXYTFJ-UHFFFAOYSA-N |
| XLogP | 6.20 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 11 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 226.45 |
| LogP ≤ 5 | 6.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5,6-diethyldodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,6-diethyldodecane?
The IUPAC name of 5,6-diethyldodecane (CID 90761715) is 5,6-diethyldodecane.
What is the SMILES notation for 5,6-diethyldodecane?
The canonical SMILES for 5,6-diethyldodecane is CCCCCCC(CC)C(CC)CCCC.
What is the InChIKey of 5,6-diethyldodecane?
The InChIKey is HGYFPKFQXXYTFJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34/c1-5-9-11-12-14-16(8-4)15(7-3)13-10-6-2/h15-16H,5-14H2,1-4H3.
What are the key properties of 5,6-diethyldodecane?
5,6-diethyldodecane has a molecular weight of 226.45 g/mol, XLogP of 6.20, 11 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5,6-diethyldodecane is sourced from PubChem (CID 90761715), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).