About 8,9-dibutylhexadecane
8,9-dibutylhexadecane (PubChem CID 530025) has the molecular formula C24H50
and a molecular weight of 338.66 g/mol. Its IUPAC name is 8,9-dibutylhexadecane.
Molecular Properties
| Compound Name | 8,9-dibutylhexadecane |
| PubChem CID | 530025 |
| Molecular Formula | C24H50 |
| Molecular Weight | 338.66 g/mol |
| Exact Mass | 338.39 |
| IUPAC Name | 8,9-dibutylhexadecane |
| SMILES | CCCCCCCC(CCCC)C(CCCC)CCCCCCC |
| InChI | InChI=1S/C24H50/c1-5-9-13-15-17-21-23(19-11-7-3)24(20-12-8-4)22-18-16-14-10-6-2/h23-24H,5-22H2,1-4H3 |
| InChIKey | ZTKGWYHUQJSRJN-UHFFFAOYSA-N |
| XLogP | 9.32 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 19 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 338.66 |
| LogP ≤ 5 | 9.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8,9-dibutylhexadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8,9-dibutylhexadecane?
The IUPAC name of 8,9-dibutylhexadecane (CID 530025) is 8,9-dibutylhexadecane.
What is the SMILES notation for 8,9-dibutylhexadecane?
The canonical SMILES for 8,9-dibutylhexadecane is CCCCCCCC(CCCC)C(CCCC)CCCCCCC.
What is the InChIKey of 8,9-dibutylhexadecane?
The InChIKey is ZTKGWYHUQJSRJN-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H50/c1-5-9-13-15-17-21-23(19-11-7-3)24(20-12-8-4)22-18-16-14-10-6-2/h23-24H,5-22H2,1-4H3.
What are the key properties of 8,9-dibutylhexadecane?
8,9-dibutylhexadecane has a molecular weight of 338.66 g/mol, XLogP of 9.32, 19 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8,9-dibutylhexadecane is sourced from PubChem (CID 530025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).