C18H36F2S2 — CID 170145624
6-[(1R)-3,3-difluoro-1-(propan-2-yldisulfanyl)propyl]dodecane (PubChem CID 170145624) has the molecular formula C18H36F2S2 and a molecular weight of 354.62 g/mol. Its IUPAC name is 6-[(1R)-3,3-difluoro-1-(propan-2-yldisulfanyl)propyl]dodecane.
| Compound Name | 6-[(1R)-3,3-difluoro-1-(propan-2-yldisulfanyl)propyl]dodecane |
|---|---|
| PubChem CID | 170145624 |
| Molecular Formula | C18H36F2S2 |
| Molecular Weight | 354.62 g/mol |
| Exact Mass | 354.22 |
| IUPAC Name | 6-[(1R)-3,3-difluoro-1-(propan-2-yldisulfanyl)propyl]dodecane |
| SMILES | CCCCCCC(CCCCC)[C@@H](CC(F)F)SSC(C)C |
| InChI | InChI=1S/C18H36F2S2/c1-5-7-9-11-13-16(12-10-8-6-2)17(14-18(19)20)22-21-15(3)4/h15-18H,5-14H2,1-4H3/t16?,17-/m1/s1 |
| InChIKey | PXPVWBBSFQFUGS-ZYMOGRSISA-N |
| XLogP | 7.97 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.62 |
| LogP ≤ 5 | 7.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|