C19H38Cl2S2 — CID 170145639
6-[(1R)-1-(tert-butyldisulfanyl)-3,3-dichloropropyl]dodecane (PubChem CID 170145639) has the molecular formula C19H38Cl2S2 and a molecular weight of 401.55 g/mol. Its IUPAC name is 6-[(1R)-1-(tert-butyldisulfanyl)-3,3-dichloropropyl]dodecane.
| Compound Name | 6-[(1R)-1-(tert-butyldisulfanyl)-3,3-dichloropropyl]dodecane |
|---|---|
| PubChem CID | 170145639 |
| Molecular Formula | C19H38Cl2S2 |
| Molecular Weight | 401.55 g/mol |
| Exact Mass | 400.18 |
| IUPAC Name | 6-[(1R)-1-(tert-butyldisulfanyl)-3,3-dichloropropyl]dodecane |
| SMILES | CCCCCCC(CCCCC)[C@@H](CC(Cl)Cl)SSC(C)(C)C |
| InChI | InChI=1S/C19H38Cl2S2/c1-6-8-10-12-14-16(13-11-9-7-2)17(15-18(20)21)22-23-19(3,4)5/h16-18H,6-15H2,1-5H3/t16?,17-/m1/s1 |
| InChIKey | UHNYBZMOPJFIPE-ZYMOGRSISA-N |
| XLogP | 8.90 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.55 |
| LogP ≤ 5 | 8.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|