C18H36Cl2S2 — CID 155048568
6-[(1R)-1-(tert-butyldisulfanyl)-2,2-dichloroethyl]dodecane (PubChem CID 155048568) has the molecular formula C18H36Cl2S2 and a molecular weight of 387.53 g/mol. Its IUPAC name is 6-[(1R)-1-(tert-butyldisulfanyl)-2,2-dichloroethyl]dodecane.
| Compound Name | 6-[(1R)-1-(tert-butyldisulfanyl)-2,2-dichloroethyl]dodecane |
|---|---|
| PubChem CID | 155048568 |
| Molecular Formula | C18H36Cl2S2 |
| Molecular Weight | 387.53 g/mol |
| Exact Mass | 386.16 |
| IUPAC Name | 6-[(1R)-1-(tert-butyldisulfanyl)-2,2-dichloroethyl]dodecane |
| SMILES | CCCCCCC(CCCCC)[C@@H](SSC(C)(C)C)C(Cl)Cl |
| InChI | InChI=1S/C18H36Cl2S2/c1-6-8-10-12-14-15(13-11-9-7-2)16(17(19)20)21-22-18(3,4)5/h15-17H,6-14H2,1-5H3/t15?,16-/m1/s1 |
| InChIKey | GLSVNUYXHMQQSY-OEMAIJDKSA-N |
| XLogP | 8.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.53 |
| LogP ≤ 5 | 8.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|