C17H33Cl3S2 — CID 155048463
6-[(1R)-2,2,2-trichloro-1-(propan-2-yldisulfanyl)ethyl]dodecane (PubChem CID 155048463) has the molecular formula C17H33Cl3S2 and a molecular weight of 407.94 g/mol. Its IUPAC name is 6-[(1R)-2,2,2-trichloro-1-(propan-2-yldisulfanyl)ethyl]dodecane.
| Compound Name | 6-[(1R)-2,2,2-trichloro-1-(propan-2-yldisulfanyl)ethyl]dodecane |
|---|---|
| PubChem CID | 155048463 |
| Molecular Formula | C17H33Cl3S2 |
| Molecular Weight | 407.94 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | 6-[(1R)-2,2,2-trichloro-1-(propan-2-yldisulfanyl)ethyl]dodecane |
| SMILES | CCCCCCC(CCCCC)[C@@H](SSC(C)C)C(Cl)(Cl)Cl |
| InChI | InChI=1S/C17H33Cl3S2/c1-5-7-9-11-13-15(12-10-8-6-2)16(17(18,19)20)22-21-14(3)4/h14-16H,5-13H2,1-4H3/t15?,16-/m1/s1 |
| InChIKey | KDCBVRBUVXPLST-OEMAIJDKSA-N |
| XLogP | 8.68 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.94 |
| LogP ≤ 5 | 8.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'disulphide', 'substructure': 'N/A'} |
|---|