About ethane;3-heptylundecan-2-ol
ethane;3-heptylundecan-2-ol (PubChem CID 165399351) has the molecular formula C20H44O
and a molecular weight of 300.57 g/mol. Its IUPAC name is ethane;3-heptylundecan-2-ol.
Molecular Properties
| Compound Name | ethane;3-heptylundecan-2-ol |
| PubChem CID | 165399351 |
| Molecular Formula | C20H44O |
| Molecular Weight | 300.57 g/mol |
| Exact Mass | 300.34 |
| IUPAC Name | ethane;3-heptylundecan-2-ol |
| SMILES | CC.CCCCCCCCC(CCCCCCC)C(C)O |
| InChI | InChI=1S/C18H38O.C2H6/c1-4-6-8-10-12-14-16-18(17(3)19)15-13-11-9-7-5-2;1-2/h17-19H,4-16H2,1-3H3;1-2H3 |
| InChIKey | OFFNEHWHWUZYDC-UHFFFAOYSA-N |
| XLogP | 7.12 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.57 |
| LogP ≤ 5 | 7.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze ethane;3-heptylundecan-2-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethane;3-heptylundecan-2-ol?
The IUPAC name of ethane;3-heptylundecan-2-ol (CID 165399351) is ethane;3-heptylundecan-2-ol.
What is the SMILES notation for ethane;3-heptylundecan-2-ol?
The canonical SMILES for ethane;3-heptylundecan-2-ol is CC.CCCCCCCCC(CCCCCCC)C(C)O.
What is the InChIKey of ethane;3-heptylundecan-2-ol?
The InChIKey is OFFNEHWHWUZYDC-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38O.C2H6/c1-4-6-8-10-12-14-16-18(17(3)19)15-13-11-9-7-5-2;1-2/h17-19H,4-16H2,1-3H3;1-2H3.
What are the key properties of ethane;3-heptylundecan-2-ol?
ethane;3-heptylundecan-2-ol has a molecular weight of 300.57 g/mol, XLogP of 7.12, 14 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethane;3-heptylundecan-2-ol is sourced from PubChem (CID 165399351), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).