About 8-propan-2-ylpentadecane
8-propan-2-ylpentadecane (PubChem CID 153475308) has the molecular formula C18H38
and a molecular weight of 254.50 g/mol. Its IUPAC name is 8-propan-2-ylpentadecane.
Molecular Properties
| Compound Name | 8-propan-2-ylpentadecane |
| PubChem CID | 153475308 |
| Molecular Formula | C18H38 |
| Molecular Weight | 254.50 g/mol |
| Exact Mass | 254.30 |
| IUPAC Name | 8-propan-2-ylpentadecane |
| SMILES | CCCCCCCC(CCCCCCC)C(C)C |
| InChI | InChI=1S/C18H38/c1-5-7-9-11-13-15-18(17(3)4)16-14-12-10-8-6-2/h17-18H,5-16H2,1-4H3 |
| InChIKey | NPIXKVWTDYHIMH-UHFFFAOYSA-N |
| XLogP | 6.98 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 254.50 |
| LogP ≤ 5 | 6.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 8-propan-2-ylpentadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-propan-2-ylpentadecane?
The IUPAC name of 8-propan-2-ylpentadecane (CID 153475308) is 8-propan-2-ylpentadecane.
What is the SMILES notation for 8-propan-2-ylpentadecane?
The canonical SMILES for 8-propan-2-ylpentadecane is CCCCCCCC(CCCCCCC)C(C)C.
What is the InChIKey of 8-propan-2-ylpentadecane?
The InChIKey is NPIXKVWTDYHIMH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H38/c1-5-7-9-11-13-15-18(17(3)4)16-14-12-10-8-6-2/h17-18H,5-16H2,1-4H3.
What are the key properties of 8-propan-2-ylpentadecane?
8-propan-2-ylpentadecane has a molecular weight of 254.50 g/mol, XLogP of 6.98, 13 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 8-propan-2-ylpentadecane is sourced from PubChem (CID 153475308), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).