C12H20F6 — CID 150236240
1,1,1-trifluoro-2-(trifluoromethyl)undecane (PubChem CID 150236240) has the molecular formula C12H20F6 and a molecular weight of 278.28 g/mol. Its IUPAC name is 1,1,1-trifluoro-2-(trifluoromethyl)undecane.
| Compound Name | 1,1,1-trifluoro-2-(trifluoromethyl)undecane |
|---|---|
| PubChem CID | 150236240 |
| Molecular Formula | C12H20F6 |
| Molecular Weight | 278.28 g/mol |
| Exact Mass | 278.15 |
| IUPAC Name | 1,1,1-trifluoro-2-(trifluoromethyl)undecane |
| SMILES | CCCCCCCCCC(C(F)(F)F)C(F)(F)F |
| InChI | InChI=1S/C12H20F6/c1-2-3-4-5-6-7-8-9-10(11(13,14)15)12(16,17)18/h10H,2-9H2,1H3 |
| InChIKey | OZYOWCASLJSORU-UHFFFAOYSA-N |
| XLogP | 5.87 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 8 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 278.28 |
| LogP ≤ 5 | 5.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|