C17H33F3 — CID 155261699
7-(1,1,1-trifluoropropan-2-yl)tetradecane (PubChem CID 155261699) has the molecular formula C17H33F3 and a molecular weight of 294.44 g/mol. Its IUPAC name is 7-(1,1,1-trifluoropropan-2-yl)tetradecane.
| Compound Name | 7-(1,1,1-trifluoropropan-2-yl)tetradecane |
|---|---|
| PubChem CID | 155261699 |
| Molecular Formula | C17H33F3 |
| Molecular Weight | 294.44 g/mol |
| Exact Mass | 294.25 |
| IUPAC Name | 7-(1,1,1-trifluoropropan-2-yl)tetradecane |
| SMILES | CCCCCCCC(CCCCCC)C(C)C(F)(F)F |
| InChI | InChI=1S/C17H33F3/c1-4-6-8-10-12-14-16(13-11-9-7-5-2)15(3)17(18,19)20/h15-16H,4-14H2,1-3H3 |
| InChIKey | IDCBFUJGPAHUSE-UHFFFAOYSA-N |
| XLogP | 7.13 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.44 |
| LogP ≤ 5 | 7.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|