About 2-fluorohenicosane
2-fluorohenicosane (PubChem CID 91354486) has the molecular formula C21H43F
and a molecular weight of 314.57 g/mol. Its IUPAC name is 2-fluorohenicosane.
Molecular Properties
| Compound Name | 2-fluorohenicosane |
| PubChem CID | 91354486 |
| Molecular Formula | C21H43F |
| Molecular Weight | 314.57 g/mol |
| Exact Mass | 314.33 |
| IUPAC Name | 2-fluorohenicosane |
| SMILES | CCCCCCCCCCCCCCCCCCCC(C)F |
| InChI | InChI=1S/C21H43F/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22/h21H,3-20H2,1-2H3 |
| InChIKey | MKKNCFJJYHGAHC-UHFFFAOYSA-N |
| XLogP | 8.39 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 18 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 314.57 |
| LogP ≤ 5 | 8.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2-fluorohenicosane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-fluorohenicosane?
The IUPAC name of 2-fluorohenicosane (CID 91354486) is 2-fluorohenicosane.
What is the SMILES notation for 2-fluorohenicosane?
The canonical SMILES for 2-fluorohenicosane is CCCCCCCCCCCCCCCCCCCC(C)F.
What is the InChIKey of 2-fluorohenicosane?
The InChIKey is MKKNCFJJYHGAHC-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H43F/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17-18-19-20-21(2)22/h21H,3-20H2,1-2H3.
What are the key properties of 2-fluorohenicosane?
2-fluorohenicosane has a molecular weight of 314.57 g/mol, XLogP of 8.39, 18 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-fluorohenicosane is sourced from PubChem (CID 91354486), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).