About 2,6-difluorooctadecane
2,6-difluorooctadecane (PubChem CID 174393944) has the molecular formula C18H36F2
and a molecular weight of 290.48 g/mol. Its IUPAC name is 2,6-difluorooctadecane.
Molecular Properties
| Compound Name | 2,6-difluorooctadecane |
| PubChem CID | 174393944 |
| Molecular Formula | C18H36F2 |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.28 |
| IUPAC Name | 2,6-difluorooctadecane |
| SMILES | CCCCCCCCCCCCC(F)CCCC(C)F |
| InChI | InChI=1S/C18H36F2/c1-3-4-5-6-7-8-9-10-11-12-15-18(20)16-13-14-17(2)19/h17-18H,3-16H2,1-2H3 |
| InChIKey | UMISLCZJGOPCFA-UHFFFAOYSA-N |
| XLogP | 7.16 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 7.16 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 2,6-difluorooctadecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,6-difluorooctadecane?
The IUPAC name of 2,6-difluorooctadecane (CID 174393944) is 2,6-difluorooctadecane.
What is the SMILES notation for 2,6-difluorooctadecane?
The canonical SMILES for 2,6-difluorooctadecane is CCCCCCCCCCCCC(F)CCCC(C)F.
What is the InChIKey of 2,6-difluorooctadecane?
The InChIKey is UMISLCZJGOPCFA-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H36F2/c1-3-4-5-6-7-8-9-10-11-12-15-18(20)16-13-14-17(2)19/h17-18H,3-16H2,1-2H3.
What are the key properties of 2,6-difluorooctadecane?
2,6-difluorooctadecane has a molecular weight of 290.48 g/mol, XLogP of 7.16, 15 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2,6-difluorooctadecane is sourced from PubChem (CID 174393944), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).