About (4R)-4-fluorodecane
(4R)-4-fluorodecane (PubChem CID 88903478) has the molecular formula C10H21F
and a molecular weight of 160.28 g/mol. Its IUPAC name is (4R)-4-fluorodecane.
Molecular Properties
| Compound Name | (4R)-4-fluorodecane |
| PubChem CID | 88903478 |
| Molecular Formula | C10H21F |
| Molecular Weight | 160.28 g/mol |
| Exact Mass | 160.16 |
| IUPAC Name | (4R)-4-fluorodecane |
| SMILES | CCCCCC[C@H](F)CCC |
| InChI | InChI=1S/C10H21F/c1-3-5-6-7-9-10(11)8-4-2/h10H,3-9H2,1-2H3/t10-/m1/s1 |
| InChIKey | FOGSKGRGRWEPCZ-SNVBAGLBSA-N |
| XLogP | 4.09 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 160.28 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (4R)-4-fluorodecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-4-fluorodecane?
The IUPAC name of (4R)-4-fluorodecane (CID 88903478) is (4R)-4-fluorodecane.
What is the SMILES notation for (4R)-4-fluorodecane?
The canonical SMILES for (4R)-4-fluorodecane is CCCCCC[C@H](F)CCC.
What is the InChIKey of (4R)-4-fluorodecane?
The InChIKey is FOGSKGRGRWEPCZ-SNVBAGLBSA-N. The full InChI is InChI=1S/C10H21F/c1-3-5-6-7-9-10(11)8-4-2/h10H,3-9H2,1-2H3/t10-/m1/s1.
What are the key properties of (4R)-4-fluorodecane?
(4R)-4-fluorodecane has a molecular weight of 160.28 g/mol, XLogP of 4.09, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-4-fluorodecane is sourced from PubChem (CID 88903478), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).