About 5-fluorononane
5-fluorononane (PubChem CID 14113820) has the molecular formula C9H19F
and a molecular weight of 146.25 g/mol. Its IUPAC name is 5-fluorononane.
Molecular Properties
| Compound Name | 5-fluorononane |
| PubChem CID | 14113820 |
| Molecular Formula | C9H19F |
| Molecular Weight | 146.25 g/mol |
| Exact Mass | 146.15 |
| IUPAC Name | 5-fluorononane |
| SMILES | CCCCC(F)CCCC |
| InChI | InChI=1S/C9H19F/c1-3-5-7-9(10)8-6-4-2/h9H,3-8H2,1-2H3 |
| InChIKey | OHHLOGCEVBSGDO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.25 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-fluorononane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-fluorononane?
The IUPAC name of 5-fluorononane (CID 14113820) is 5-fluorononane.
What is the SMILES notation for 5-fluorononane?
The canonical SMILES for 5-fluorononane is CCCCC(F)CCCC.
What is the InChIKey of 5-fluorononane?
The InChIKey is OHHLOGCEVBSGDO-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H19F/c1-3-5-7-9(10)8-6-4-2/h9H,3-8H2,1-2H3.
What are the key properties of 5-fluorononane?
5-fluorononane has a molecular weight of 146.25 g/mol, XLogP of 3.70, 6 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-fluorononane is sourced from PubChem (CID 14113820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).