About sodium 5-fluorononanoate
sodium 5-fluorononanoate (PubChem CID 101279287) has the molecular formula C9H16FNaO2
and a molecular weight of 198.21 g/mol. Its IUPAC name is sodium 5-fluorononanoate.
Molecular Properties
| Compound Name | sodium 5-fluorononanoate |
| PubChem CID | 101279287 |
| Molecular Formula | C9H16FNaO2 |
| Molecular Weight | 198.21 g/mol |
| Exact Mass | 198.10 |
| IUPAC Name | sodium 5-fluorononanoate |
| SMILES | CCCCC(F)CCCC(=O)[O-].[Na+] |
| InChI | InChI=1S/C9H17FO2.Na/c1-2-3-5-8(10)6-4-7-9(11)12;/h8H,2-7H2,1H3,(H,11,12);/q;+1/p-1 |
| InChIKey | XBKFQWWJDFDDCS-UHFFFAOYSA-M |
| XLogP | -1.56 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 198.21 |
| LogP ≤ 5 | -1.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze sodium 5-fluorononanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of sodium 5-fluorononanoate?
The IUPAC name of sodium 5-fluorononanoate (CID 101279287) is sodium 5-fluorononanoate.
What is the SMILES notation for sodium 5-fluorononanoate?
The canonical SMILES for sodium 5-fluorononanoate is CCCCC(F)CCCC(=O)[O-].[Na+].
What is the InChIKey of sodium 5-fluorononanoate?
The InChIKey is XBKFQWWJDFDDCS-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H17FO2.Na/c1-2-3-5-8(10)6-4-7-9(11)12;/h8H,2-7H2,1H3,(H,11,12);/q;+1/p-1.
What are the key properties of sodium 5-fluorononanoate?
sodium 5-fluorononanoate has a molecular weight of 198.21 g/mol, XLogP of -1.56, 7 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for sodium 5-fluorononanoate is sourced from PubChem (CID 101279287), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).