About hexanoate;indium(3+);dihydroxide
hexanoate;indium(3+);dihydroxide (PubChem CID 157267600) has the molecular formula C6H13InO4
and a molecular weight of 263.98 g/mol. Its IUPAC name is hexanoate;indium(3+);dihydroxide.
Molecular Properties
| Compound Name | hexanoate;indium(3+);dihydroxide |
| PubChem CID | 157267600 |
| Molecular Formula | C6H13InO4 |
| Molecular Weight | 263.98 g/mol |
| Exact Mass | 263.99 |
| IUPAC Name | hexanoate;indium(3+);dihydroxide |
| SMILES | CCCCCC(=O)[O-].[In+3].[OH-].[OH-] |
| InChI | InChI=1S/C6H12O2.In.2H2O/c1-2-3-4-5-6(7)8;;;/h2-5H2,1H3,(H,7,8);;2*1H2/q;+3;;/p-3 |
| InChIKey | AYEFIFWFMFBMMF-UHFFFAOYSA-K |
| XLogP | -0.42 |
| TPSA | 100.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 263.98 |
| LogP ≤ 5 | -0.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze hexanoate;indium(3+);dihydroxide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexanoate;indium(3+);dihydroxide?
The IUPAC name of hexanoate;indium(3+);dihydroxide (CID 157267600) is hexanoate;indium(3+);dihydroxide.
What is the SMILES notation for hexanoate;indium(3+);dihydroxide?
The canonical SMILES for hexanoate;indium(3+);dihydroxide is CCCCCC(=O)[O-].[In+3].[OH-].[OH-].
What is the InChIKey of hexanoate;indium(3+);dihydroxide?
The InChIKey is AYEFIFWFMFBMMF-UHFFFAOYSA-K. The full InChI is InChI=1S/C6H12O2.In.2H2O/c1-2-3-4-5-6(7)8;;;/h2-5H2,1H3,(H,7,8);;2*1H2/q;+3;;/p-3.
What are the key properties of hexanoate;indium(3+);dihydroxide?
hexanoate;indium(3+);dihydroxide has a molecular weight of 263.98 g/mol, XLogP of -0.42, 4 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for hexanoate;indium(3+);dihydroxide is sourced from PubChem (CID 157267600), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).