About 5-sulfanylnonanoate
5-sulfanylnonanoate (PubChem CID 20837855) has the molecular formula C9H17O2S-
and a molecular weight of 189.30 g/mol. Its IUPAC name is 5-sulfanylnonanoate.
Molecular Properties
| Compound Name | 5-sulfanylnonanoate |
| PubChem CID | 20837855 |
| Molecular Formula | C9H17O2S- |
| Molecular Weight | 189.30 g/mol |
| Exact Mass | 189.10 |
| IUPAC Name | 5-sulfanylnonanoate |
| SMILES | CCCCC(S)CCCC(=O)[O-] |
| InChI | InChI=1S/C9H18O2S/c1-2-3-5-8(12)6-4-7-9(10)11/h8,12H,2-7H2,1H3,(H,10,11)/p-1 |
| InChIKey | DNXSTABBZHVTPQ-UHFFFAOYSA-M |
| XLogP | 1.40 |
| TPSA | 40.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 189.30 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 5-sulfanylnonanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-sulfanylnonanoate?
The IUPAC name of 5-sulfanylnonanoate (CID 20837855) is 5-sulfanylnonanoate.
What is the SMILES notation for 5-sulfanylnonanoate?
The canonical SMILES for 5-sulfanylnonanoate is CCCCC(S)CCCC(=O)[O-].
What is the InChIKey of 5-sulfanylnonanoate?
The InChIKey is DNXSTABBZHVTPQ-UHFFFAOYSA-M. The full InChI is InChI=1S/C9H18O2S/c1-2-3-5-8(12)6-4-7-9(10)11/h8,12H,2-7H2,1H3,(H,10,11)/p-1.
What are the key properties of 5-sulfanylnonanoate?
5-sulfanylnonanoate has a molecular weight of 189.30 g/mol, XLogP of 1.40, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 5-sulfanylnonanoate is sourced from PubChem (CID 20837855), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).