About magnesium bis(5-propyloctanoate)
magnesium bis(5-propyloctanoate) (PubChem CID 88756232) has the molecular formula C22H42MgO4
and a molecular weight of 394.88 g/mol. Its IUPAC name is magnesium bis(5-propyloctanoate).
Molecular Properties
| Compound Name | magnesium bis(5-propyloctanoate) |
| PubChem CID | 88756232 |
| Molecular Formula | C22H42MgO4 |
| Molecular Weight | 394.88 g/mol |
| Exact Mass | 394.29 |
| IUPAC Name | magnesium bis(5-propyloctanoate) |
| SMILES | CCCC(CCC)CCCC(=O)[O-].CCCC(CCC)CCCC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C11H22O2.Mg/c2*1-3-6-10(7-4-2)8-5-9-11(12)13;/h2*10H,3-9H2,1-2H3,(H,12,13);/q;;+2/p-2 |
| InChIKey | CWJNCUIIJXNLTH-UHFFFAOYSA-L |
| XLogP | 3.87 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 27 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 394.88 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium bis(5-propyloctanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(5-propyloctanoate)?
The IUPAC name of magnesium bis(5-propyloctanoate) (CID 88756232) is magnesium bis(5-propyloctanoate).
What is the SMILES notation for magnesium bis(5-propyloctanoate)?
The canonical SMILES for magnesium bis(5-propyloctanoate) is CCCC(CCC)CCCC(=O)[O-].CCCC(CCC)CCCC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(5-propyloctanoate)?
The InChIKey is CWJNCUIIJXNLTH-UHFFFAOYSA-L. The full InChI is InChI=1S/2C11H22O2.Mg/c2*1-3-6-10(7-4-2)8-5-9-11(12)13;/h2*10H,3-9H2,1-2H3,(H,12,13);/q;;+2/p-2.
What are the key properties of magnesium bis(5-propyloctanoate)?
magnesium bis(5-propyloctanoate) has a molecular weight of 394.88 g/mol, XLogP of 3.87, 16 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(5-propyloctanoate) is sourced from PubChem (CID 88756232), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).