About magnesium bis(3-propylhexanoate)
magnesium bis(3-propylhexanoate) (PubChem CID 88756226) has the molecular formula C18H34MgO4
and a molecular weight of 338.77 g/mol. Its IUPAC name is magnesium bis(3-propylhexanoate).
Molecular Properties
| Compound Name | magnesium bis(3-propylhexanoate) |
| PubChem CID | 88756226 |
| Molecular Formula | C18H34MgO4 |
| Molecular Weight | 338.77 g/mol |
| Exact Mass | 338.23 |
| IUPAC Name | magnesium bis(3-propylhexanoate) |
| SMILES | CCCC(CCC)CC(=O)[O-].CCCC(CCC)CC(=O)[O-].[Mg+2] |
| InChI | InChI=1S/2C9H18O2.Mg/c2*1-3-5-8(6-4-2)7-9(10)11;/h2*8H,3-7H2,1-2H3,(H,10,11);/q;;+2/p-2 |
| InChIKey | AIXSPNTWIRMWAC-UHFFFAOYSA-L |
| XLogP | 2.30 |
| TPSA | 80.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 338.77 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze magnesium bis(3-propylhexanoate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of magnesium bis(3-propylhexanoate)?
The IUPAC name of magnesium bis(3-propylhexanoate) (CID 88756226) is magnesium bis(3-propylhexanoate).
What is the SMILES notation for magnesium bis(3-propylhexanoate)?
The canonical SMILES for magnesium bis(3-propylhexanoate) is CCCC(CCC)CC(=O)[O-].CCCC(CCC)CC(=O)[O-].[Mg+2].
What is the InChIKey of magnesium bis(3-propylhexanoate)?
The InChIKey is AIXSPNTWIRMWAC-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H18O2.Mg/c2*1-3-5-8(6-4-2)7-9(10)11;/h2*8H,3-7H2,1-2H3,(H,10,11);/q;;+2/p-2.
What are the key properties of magnesium bis(3-propylhexanoate)?
magnesium bis(3-propylhexanoate) has a molecular weight of 338.77 g/mol, XLogP of 2.30, 12 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for magnesium bis(3-propylhexanoate) is sourced from PubChem (CID 88756226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).