C10H19O2Rb — CID 59788976
(3R,5R)-3,5-dimethyloctanoate;rubidium(1+) (PubChem CID 59788976) has the molecular formula C10H19O2Rb and a molecular weight of 256.73 g/mol. Its IUPAC name is (3R,5R)-3,5-dimethyloctanoate;rubidium(1+).
| Compound Name | (3R,5R)-3,5-dimethyloctanoate;rubidium(1+) |
|---|---|
| PubChem CID | 59788976 |
| Molecular Formula | C10H19O2Rb |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.05 |
| IUPAC Name | (3R,5R)-3,5-dimethyloctanoate;rubidium(1+) |
| SMILES | CCC[C@@H](C)C[C@@H](C)CC(=O)[O-].[Rb+] |
| InChI | InChI=1S/C10H20O2.Rb/c1-4-5-8(2)6-9(3)7-10(11)12;/h8-9H,4-7H2,1-3H3,(H,11,12);/q;+1/p-1/t8-,9-;/m1./s1 |
| InChIKey | OZVJXZBQJSXQAA-VTLYIQCISA-M |
| XLogP | -1.41 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | -1.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |