About dilithium;2-oxo-3-propylpentanedioate
dilithium;2-oxo-3-propylpentanedioate (PubChem CID 23628472) has the molecular formula C8H10Li2O5
and a molecular weight of 200.04 g/mol. Its IUPAC name is dilithium;2-oxo-3-propylpentanedioate.
Molecular Properties
| Compound Name | dilithium;2-oxo-3-propylpentanedioate |
| PubChem CID | 23628472 |
| Molecular Formula | C8H10Li2O5 |
| Molecular Weight | 200.04 g/mol |
| Exact Mass | 200.08 |
| IUPAC Name | dilithium;2-oxo-3-propylpentanedioate |
| SMILES | CCCC(CC(=O)[O-])C(=O)C(=O)[O-].[Li+].[Li+] |
| InChI | InChI=1S/C8H12O5.2Li/c1-2-3-5(4-6(9)10)7(11)8(12)13;;/h5H,2-4H2,1H3,(H,9,10)(H,12,13);;/q;2*+1/p-2 |
| InChIKey | ISCZXXZHTKAYPI-UHFFFAOYSA-L |
| XLogP | -8.13 |
| TPSA | 97.33 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 200.04 |
| LogP ≤ 5 | -8.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze dilithium;2-oxo-3-propylpentanedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dilithium;2-oxo-3-propylpentanedioate?
The IUPAC name of dilithium;2-oxo-3-propylpentanedioate (CID 23628472) is dilithium;2-oxo-3-propylpentanedioate.
What is the SMILES notation for dilithium;2-oxo-3-propylpentanedioate?
The canonical SMILES for dilithium;2-oxo-3-propylpentanedioate is CCCC(CC(=O)[O-])C(=O)C(=O)[O-].[Li+].[Li+].
What is the InChIKey of dilithium;2-oxo-3-propylpentanedioate?
The InChIKey is ISCZXXZHTKAYPI-UHFFFAOYSA-L. The full InChI is InChI=1S/C8H12O5.2Li/c1-2-3-5(4-6(9)10)7(11)8(12)13;;/h5H,2-4H2,1H3,(H,9,10)(H,12,13);;/q;2*+1/p-2.
What are the key properties of dilithium;2-oxo-3-propylpentanedioate?
dilithium;2-oxo-3-propylpentanedioate has a molecular weight of 200.04 g/mol, XLogP of -8.13, 6 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for dilithium;2-oxo-3-propylpentanedioate is sourced from PubChem (CID 23628472), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).