About potassium 3-carboxyheptanoate
potassium 3-carboxyheptanoate (PubChem CID 102118519) has the molecular formula C8H13KO4
and a molecular weight of 212.29 g/mol. Its IUPAC name is potassium 3-carboxyheptanoate.
Molecular Properties
| Compound Name | potassium 3-carboxyheptanoate |
| PubChem CID | 102118519 |
| Molecular Formula | C8H13KO4 |
| Molecular Weight | 212.29 g/mol |
| Exact Mass | 212.05 |
| IUPAC Name | potassium 3-carboxyheptanoate |
| SMILES | CCCCC(CC(=O)[O-])C(=O)O.[K+] |
| InChI | InChI=1S/C8H14O4.K/c1-2-3-4-6(8(11)12)5-7(9)10;/h6H,2-5H2,1H3,(H,9,10)(H,11,12);/q;+1/p-1 |
| InChIKey | OEISUMNRUKMRQY-UHFFFAOYSA-M |
| XLogP | -2.98 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 212.29 |
| LogP ≤ 5 | -2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze potassium 3-carboxyheptanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of potassium 3-carboxyheptanoate?
The IUPAC name of potassium 3-carboxyheptanoate (CID 102118519) is potassium 3-carboxyheptanoate.
What is the SMILES notation for potassium 3-carboxyheptanoate?
The canonical SMILES for potassium 3-carboxyheptanoate is CCCCC(CC(=O)[O-])C(=O)O.[K+].
What is the InChIKey of potassium 3-carboxyheptanoate?
The InChIKey is OEISUMNRUKMRQY-UHFFFAOYSA-M. The full InChI is InChI=1S/C8H14O4.K/c1-2-3-4-6(8(11)12)5-7(9)10;/h6H,2-5H2,1H3,(H,9,10)(H,11,12);/q;+1/p-1.
What are the key properties of potassium 3-carboxyheptanoate?
potassium 3-carboxyheptanoate has a molecular weight of 212.29 g/mol, XLogP of -2.98, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for potassium 3-carboxyheptanoate is sourced from PubChem (CID 102118519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).