About zinc;2-ethylhexanoate;2-ethylhexanoic acid
zinc;2-ethylhexanoate;2-ethylhexanoic acid (PubChem CID 165000820) has the molecular formula C16H31O4Zn+
and a molecular weight of 352.81 g/mol. Its IUPAC name is zinc;2-ethylhexanoate;2-ethylhexanoic acid.
Molecular Properties
| Compound Name | zinc;2-ethylhexanoate;2-ethylhexanoic acid |
| PubChem CID | 165000820 |
| Molecular Formula | C16H31O4Zn+ |
| Molecular Weight | 352.81 g/mol |
| Exact Mass | 351.15 |
| IUPAC Name | zinc;2-ethylhexanoate;2-ethylhexanoic acid |
| SMILES | CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)[O-].[Zn+2] |
| InChI | InChI=1S/2C8H16O2.Zn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-1 |
| InChIKey | IFNXAMCERSVZCV-UHFFFAOYSA-M |
| XLogP | 3.24 |
| TPSA | 77.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 352.81 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-ethylhexanoate;2-ethylhexanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-ethylhexanoate;2-ethylhexanoic acid?
The IUPAC name of zinc;2-ethylhexanoate;2-ethylhexanoic acid (CID 165000820) is zinc;2-ethylhexanoate;2-ethylhexanoic acid.
What is the SMILES notation for zinc;2-ethylhexanoate;2-ethylhexanoic acid?
The canonical SMILES for zinc;2-ethylhexanoate;2-ethylhexanoic acid is CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)[O-].[Zn+2].
What is the InChIKey of zinc;2-ethylhexanoate;2-ethylhexanoic acid?
The InChIKey is IFNXAMCERSVZCV-UHFFFAOYSA-M. The full InChI is InChI=1S/2C8H16O2.Zn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+2/p-1.
What are the key properties of zinc;2-ethylhexanoate;2-ethylhexanoic acid?
zinc;2-ethylhexanoate;2-ethylhexanoic acid has a molecular weight of 352.81 g/mol, XLogP of 3.24, 10 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-ethylhexanoate;2-ethylhexanoic acid is sourced from PubChem (CID 165000820), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).