copper 2-ethylhexanoic acid

C8H16CuO2+2 — CID 54604905

IUPACcopper 2-ethylhexanoic acid
SMILESCCCCC(CC)C(=O)O.[Cu+2]
InChIInChI=1S/C8H16O2.Cu/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+2
InChIKeyGCSZBOHZSIZLDV-UHFFFAOYSA-N
MW207.76 g/mol
LogP2.28
Rot. Bonds5

About copper 2-ethylhexanoic acid

copper 2-ethylhexanoic acid (PubChem CID 54604905) has the molecular formula C8H16CuO2+2 and a molecular weight of 207.76 g/mol. Its IUPAC name is copper 2-ethylhexanoic acid.

Molecular Properties

Compound Namecopper 2-ethylhexanoic acid
PubChem CID54604905
Molecular FormulaC8H16CuO2+2
Molecular Weight207.76 g/mol
Exact Mass207.04
IUPAC Namecopper 2-ethylhexanoic acid
SMILESCCCCC(CC)C(=O)O.[Cu+2]
InChIInChI=1S/C8H16O2.Cu/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+2
InChIKeyGCSZBOHZSIZLDV-UHFFFAOYSA-N
XLogP2.28
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors1
Rotatable Bonds5
Heavy Atoms11
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500207.76
LogP ≤ 52.28
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 101

Analyze copper 2-ethylhexanoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of copper 2-ethylhexanoic acid?
The IUPAC name of copper 2-ethylhexanoic acid (CID 54604905) is copper 2-ethylhexanoic acid.
What is the SMILES notation for copper 2-ethylhexanoic acid?
The canonical SMILES for copper 2-ethylhexanoic acid is CCCCC(CC)C(=O)O.[Cu+2].
What is the InChIKey of copper 2-ethylhexanoic acid?
The InChIKey is GCSZBOHZSIZLDV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.Cu/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);/q;+2.
What are the key properties of copper 2-ethylhexanoic acid?
copper 2-ethylhexanoic acid has a molecular weight of 207.76 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for copper 2-ethylhexanoic acid is sourced from PubChem (CID 54604905), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).