About bis(2-ethylhexanoic acid);manganese(3+)
bis(2-ethylhexanoic acid);manganese(3+) (PubChem CID 175736722) has the molecular formula C16H32MnO4+3
and a molecular weight of 343.37 g/mol. Its IUPAC name is bis(2-ethylhexanoic acid);manganese(3+).
Molecular Properties
| Compound Name | bis(2-ethylhexanoic acid);manganese(3+) |
| PubChem CID | 175736722 |
| Molecular Formula | C16H32MnO4+3 |
| Molecular Weight | 343.37 g/mol |
| Exact Mass | 343.17 |
| IUPAC Name | bis(2-ethylhexanoic acid);manganese(3+) |
| SMILES | CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.[Mn+3] |
| InChI | InChI=1S/2C8H16O2.Mn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+3 |
| InChIKey | PVDVQEXLCSCHGM-UHFFFAOYSA-N |
| XLogP | 4.57 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.37 |
| LogP ≤ 5 | 4.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze bis(2-ethylhexanoic acid);manganese(3+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-ethylhexanoic acid);manganese(3+)?
The IUPAC name of bis(2-ethylhexanoic acid);manganese(3+) (CID 175736722) is bis(2-ethylhexanoic acid);manganese(3+).
What is the SMILES notation for bis(2-ethylhexanoic acid);manganese(3+)?
The canonical SMILES for bis(2-ethylhexanoic acid);manganese(3+) is CCCCC(CC)C(=O)O.CCCCC(CC)C(=O)O.[Mn+3].
What is the InChIKey of bis(2-ethylhexanoic acid);manganese(3+)?
The InChIKey is PVDVQEXLCSCHGM-UHFFFAOYSA-N. The full InChI is InChI=1S/2C8H16O2.Mn/c2*1-3-5-6-7(4-2)8(9)10;/h2*7H,3-6H2,1-2H3,(H,9,10);/q;;+3.
What are the key properties of bis(2-ethylhexanoic acid);manganese(3+)?
bis(2-ethylhexanoic acid);manganese(3+) has a molecular weight of 343.37 g/mol, XLogP of 4.57, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-ethylhexanoic acid);manganese(3+) is sourced from PubChem (CID 175736722), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).