About 2-ethylhexanoic acid;niobium
2-ethylhexanoic acid;niobium (PubChem CID 87060397) has the molecular formula C8H16NbO2
and a molecular weight of 237.12 g/mol. Its IUPAC name is 2-ethylhexanoic acid;niobium.
Molecular Properties
| Compound Name | 2-ethylhexanoic acid;niobium |
| PubChem CID | 87060397 |
| Molecular Formula | C8H16NbO2 |
| Molecular Weight | 237.12 g/mol |
| Exact Mass | 237.02 |
| IUPAC Name | 2-ethylhexanoic acid;niobium |
| SMILES | CCCCC(CC)C(=O)O.[Nb] |
| InChI | InChI=1S/C8H16O2.Nb/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10); |
| InChIKey | JGUAIAMPONKRLK-UHFFFAOYSA-N |
| XLogP | 2.28 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 237.12 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-ethylhexanoic acid;niobium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethylhexanoic acid;niobium?
The IUPAC name of 2-ethylhexanoic acid;niobium (CID 87060397) is 2-ethylhexanoic acid;niobium.
What is the SMILES notation for 2-ethylhexanoic acid;niobium?
The canonical SMILES for 2-ethylhexanoic acid;niobium is CCCCC(CC)C(=O)O.[Nb].
What is the InChIKey of 2-ethylhexanoic acid;niobium?
The InChIKey is JGUAIAMPONKRLK-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.Nb/c1-3-5-6-7(4-2)8(9)10;/h7H,3-6H2,1-2H3,(H,9,10);.
What are the key properties of 2-ethylhexanoic acid;niobium?
2-ethylhexanoic acid;niobium has a molecular weight of 237.12 g/mol, XLogP of 2.28, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethylhexanoic acid;niobium is sourced from PubChem (CID 87060397), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).