About cyclohexane;2-ethylhexanoic acid;nickel
cyclohexane;2-ethylhexanoic acid;nickel (PubChem CID 174366727) has the molecular formula C14H28NiO2
and a molecular weight of 287.07 g/mol. Its IUPAC name is cyclohexane;2-ethylhexanoic acid;nickel.
Molecular Properties
| Compound Name | cyclohexane;2-ethylhexanoic acid;nickel |
| PubChem CID | 174366727 |
| Molecular Formula | C14H28NiO2 |
| Molecular Weight | 287.07 g/mol |
| Exact Mass | 286.14 |
| IUPAC Name | cyclohexane;2-ethylhexanoic acid;nickel |
| SMILES | C1CCCCC1.CCCCC(CC)C(=O)O.[Ni] |
| InChI | InChI=1S/C8H16O2.C6H12.Ni/c1-3-5-6-7(4-2)8(9)10;1-2-4-6-5-3-1;/h7H,3-6H2,1-2H3,(H,9,10);1-6H2; |
| InChIKey | LODYFFFEMXSDNA-UHFFFAOYSA-N |
| XLogP | 4.63 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 287.07 |
| LogP ≤ 5 | 4.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze cyclohexane;2-ethylhexanoic acid;nickel with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexane;2-ethylhexanoic acid;nickel?
The IUPAC name of cyclohexane;2-ethylhexanoic acid;nickel (CID 174366727) is cyclohexane;2-ethylhexanoic acid;nickel.
What is the SMILES notation for cyclohexane;2-ethylhexanoic acid;nickel?
The canonical SMILES for cyclohexane;2-ethylhexanoic acid;nickel is C1CCCCC1.CCCCC(CC)C(=O)O.[Ni].
What is the InChIKey of cyclohexane;2-ethylhexanoic acid;nickel?
The InChIKey is LODYFFFEMXSDNA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H16O2.C6H12.Ni/c1-3-5-6-7(4-2)8(9)10;1-2-4-6-5-3-1;/h7H,3-6H2,1-2H3,(H,9,10);1-6H2;.
What are the key properties of cyclohexane;2-ethylhexanoic acid;nickel?
cyclohexane;2-ethylhexanoic acid;nickel has a molecular weight of 287.07 g/mol, XLogP of 4.63, 5 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexane;2-ethylhexanoic acid;nickel is sourced from PubChem (CID 174366727), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).